C8H14F5NO — CID 90119324
3-amino-6,6,7,7,7-pentafluoro-2-methylheptan-2-ol (PubChem CID 90119324) has the molecular formula C8H14F5NO and a molecular weight of 235.20 g/mol. Its IUPAC name is 3-amino-6,6,7,7,7-pentafluoro-2-methylheptan-2-ol.
| Compound Name | 3-amino-6,6,7,7,7-pentafluoro-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 90119324 |
| Molecular Formula | C8H14F5NO |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-amino-6,6,7,7,7-pentafluoro-2-methylheptan-2-ol |
| SMILES | CC(C)(O)C(N)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H14F5NO/c1-6(2,15)5(14)3-4-7(9,10)8(11,12)13/h5,15H,3-4,14H2,1-2H3 |
| InChIKey | WMYXEBSSAUGZFV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|