C17H28Cl2NO4PS3 — CID 90119412
2-amino-3-methylpentanoic acid;(2,5-dichlorophenyl)sulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane (PubChem CID 90119412) has the molecular formula C17H28Cl2NO4PS3 and a molecular weight of 508.50 g/mol. Its IUPAC name is 2-amino-3-methylpentanoic acid;(2,5-dichlorophenyl)sulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane.
| Compound Name | 2-amino-3-methylpentanoic acid;(2,5-dichlorophenyl)sulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 90119412 |
| Molecular Formula | C17H28Cl2NO4PS3 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | 2-amino-3-methylpentanoic acid;(2,5-dichlorophenyl)sulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCC(C)C(N)C(=O)O.CCOP(=S)(OCC)SCSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H15Cl2O2PS3.C6H13NO2/c1-3-14-16(17,15-4-2)19-8-18-11-7-9(12)5-6-10(11)13;1-3-4(2)5(7)6(8)9/h5-7H,3-4,8H2,1-2H3;4-5H,3,7H2,1-2H3,(H,8,9) |
| InChIKey | JEPXOFMAJRHALZ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|