C14H22Cl2NO4PS4 — CID 90119734
2-amino-3-sulfanylpropanoic acid;(2,5-dichlorophenyl)sulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane (PubChem CID 90119734) has the molecular formula C14H22Cl2NO4PS4 and a molecular weight of 498.48 g/mol. Its IUPAC name is 2-amino-3-sulfanylpropanoic acid;(2,5-dichlorophenyl)sulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane.
| Compound Name | 2-amino-3-sulfanylpropanoic acid;(2,5-dichlorophenyl)sulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 90119734 |
| Molecular Formula | C14H22Cl2NO4PS4 |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 496.95 |
| IUPAC Name | 2-amino-3-sulfanylpropanoic acid;(2,5-dichlorophenyl)sulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCOP(=S)(OCC)SCSc1cc(Cl)ccc1Cl.NC(CS)C(=O)O |
| InChI | InChI=1S/C11H15Cl2O2PS3.C3H7NO2S/c1-3-14-16(17,15-4-2)19-8-18-11-7-9(12)5-6-10(11)13;4-2(1-7)3(5)6/h5-7H,3-4,8H2,1-2H3;2,7H,1,4H2,(H,5,6) |
| InChIKey | QOLCUOAKWSXUKG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|