C11H15AlCl2O2PS3 — CID 87590812
CID 87590812 (PubChem CID 87590812) has the molecular formula C11H15AlCl2O2PS3 and a molecular weight of 404.30 g/mol.
| Compound Name | CID 87590812 |
|---|---|
| PubChem CID | 87590812 |
| Molecular Formula | C11H15AlCl2O2PS3 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 402.92 |
| IUPAC Name | — |
| SMILES | CCOP(=S)(OCC)SCSc1cc(Cl)ccc1Cl.[Al] |
| InChI | InChI=1S/C11H15Cl2O2PS3.Al/c1-3-14-16(17,15-4-2)19-8-18-11-7-9(12)5-6-10(11)13;/h5-7H,3-4,8H2,1-2H3; |
| InChIKey | QRCRKEUHIPWZNB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|