C15H23Cl2N2O5PS3 — CID 90119428
2,4-diamino-4-oxobutanoic acid;(2,5-dichlorophenyl)sulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane (PubChem CID 90119428) has the molecular formula C15H23Cl2N2O5PS3 and a molecular weight of 509.44 g/mol. Its IUPAC name is 2,4-diamino-4-oxobutanoic acid;(2,5-dichlorophenyl)sulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane.
| Compound Name | 2,4-diamino-4-oxobutanoic acid;(2,5-dichlorophenyl)sulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 90119428 |
| Molecular Formula | C15H23Cl2N2O5PS3 |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 507.99 |
| IUPAC Name | 2,4-diamino-4-oxobutanoic acid;(2,5-dichlorophenyl)sulfanylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCOP(=S)(OCC)SCSc1cc(Cl)ccc1Cl.NC(=O)CC(N)C(=O)O |
| InChI | InChI=1S/C11H15Cl2O2PS3.C4H8N2O3/c1-3-14-16(17,15-4-2)19-8-18-11-7-9(12)5-6-10(11)13;5-2(4(8)9)1-3(6)7/h5-7H,3-4,8H2,1-2H3;2H,1,5H2,(H2,6,7)(H,8,9) |
| InChIKey | SQEGLZPQMPTOOG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|