C15H18N8S — CID 90121949
4-N-(1,3-benzothiazol-2-yl)-6-N-methyl-2-N-pyrrolidin-3-yl-1,3,5-triazine-2,4,6-triamine (PubChem CID 90121949) has the molecular formula C15H18N8S and a molecular weight of 342.43 g/mol. Its IUPAC name is 4-N-(1,3-benzothiazol-2-yl)-6-N-methyl-2-N-pyrrolidin-3-yl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(1,3-benzothiazol-2-yl)-6-N-methyl-2-N-pyrrolidin-3-yl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 90121949 |
| Molecular Formula | C15H18N8S |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 4-N-(1,3-benzothiazol-2-yl)-6-N-methyl-2-N-pyrrolidin-3-yl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(Nc2nc3ccccc3s2)nc(NC2CCNC2)n1 |
| InChI | InChI=1S/C15H18N8S/c1-16-12-20-13(18-9-6-7-17-8-9)22-14(21-12)23-15-19-10-4-2-3-5-11(10)24-15/h2-5,9,17H,6-8H2,1H3,(H3,16,18,19,20,21,22,23) |
| InChIKey | MYJFQLQNRSLLJH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |