C22H32O3 — CID 90135269
methyl 3-[(3aS,5R,6R,6aS)-6-[(1E,3E)-3,7-dimethylocta-1,3,6-trienyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propanoate (PubChem CID 90135269) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is methyl 3-[(3aS,5R,6R,6aS)-6-[(1E,3E)-3,7-dimethylocta-1,3,6-trienyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propanoate.
| Compound Name | methyl 3-[(3aS,5R,6R,6aS)-6-[(1E,3E)-3,7-dimethylocta-1,3,6-trienyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propanoate |
|---|---|
| PubChem CID | 90135269 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | methyl 3-[(3aS,5R,6R,6aS)-6-[(1E,3E)-3,7-dimethylocta-1,3,6-trienyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C[C@H]2C[C@@H](O)[C@H](/C=C/C(C)=C/CC=C(C)C)[C@H]2C1 |
| InChI | InChI=1S/C22H32O3/c1-15(2)6-5-7-16(3)8-10-19-20-13-17(9-11-22(24)25-4)12-18(20)14-21(19)23/h6-8,10,12,18-21,23H,5,9,11,13-14H2,1-4H3/b10-8+,16-7+/t18-,19+,20-,21+/m0/s1 |
| InChIKey | FFRDJXXFPMIHPN-LHTMNUOMSA-N |
| XLogP | 4.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|