C9H19N5O — CID 90245822
(Z)-4-(2-aminoethylamino)-N-methyl-4-(methyliminomethylamino)but-3-enamide (PubChem CID 90245822) has the molecular formula C9H19N5O and a molecular weight of 213.28 g/mol. Its IUPAC name is (Z)-4-(2-aminoethylamino)-N-methyl-4-(methyliminomethylamino)but-3-enamide.
| Compound Name | (Z)-4-(2-aminoethylamino)-N-methyl-4-(methyliminomethylamino)but-3-enamide |
|---|---|
| PubChem CID | 90245822 |
| Molecular Formula | C9H19N5O |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | (Z)-4-(2-aminoethylamino)-N-methyl-4-(methyliminomethylamino)but-3-enamide |
| SMILES | C/N=C/N/C(=C\CC(=O)NC)NCCN |
| InChI | InChI=1S/C9H19N5O/c1-11-7-14-8(13-6-5-10)3-4-9(15)12-2/h3,7,13H,4-6,10H2,1-2H3,(H,11,14)(H,12,15)/b8-3- |
| InChIKey | WWGUOJXERBMJPR-BAQGIRSFSA-N |
| XLogP | -1.24 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|