C12H25B2O3 — CID 90346656
CID 90346656 (PubChem CID 90346656) has the molecular formula C12H25B2O3 and a molecular weight of 238.95 g/mol.
| Compound Name | CID 90346656 |
|---|---|
| PubChem CID | 90346656 |
| Molecular Formula | C12H25B2O3 |
| Molecular Weight | 238.95 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | — |
| SMILES | CC(C)C(C)(C)O[B]B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H25B2O3/c1-9(2)10(3,4)15-13-14-16-11(5,6)12(7,8)17-14/h9H,1-8H3 |
| InChIKey | CLFSAXOLTNYHTR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.95 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|