C21H24O10 — CID 90367864
(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 90367864) has the molecular formula C21H24O10 and a molecular weight of 436.41 g/mol. Its IUPAC name is (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 90367864 |
| Molecular Formula | C21H24O10 |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OC2C(=O)OC3C4OC(C)(C)OC4OC23)cc(OC)c1OC |
| InChI | InChI=1S/C21H24O10/c1-21(2)30-18-16-15(29-20(18)31-21)17(19(23)28-16)27-13(22)7-6-10-8-11(24-3)14(26-5)12(9-10)25-4/h6-9,15-18,20H,1-5H3/b7-6+ |
| InChIKey | CNWKCFYDPUJTTA-VOTSOKGWSA-N |
| XLogP | 1.44 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|