C2H6O6P+ — CID 90440402
1,2-dihydroperoxyethyl-hydroxy-oxophosphanium (PubChem CID 90440402) has the molecular formula C2H6O6P+ and a molecular weight of 157.04 g/mol. Its IUPAC name is 1,2-dihydroperoxyethyl-hydroxy-oxophosphanium.
| Compound Name | 1,2-dihydroperoxyethyl-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90440402 |
| Molecular Formula | C2H6O6P+ |
| Molecular Weight | 157.04 g/mol |
| Exact Mass | 156.99 |
| IUPAC Name | 1,2-dihydroperoxyethyl-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)C(COO)OO |
| InChI | InChI=1S/C2H5O6P/c3-7-1-2(8-4)9(5)6/h2H,1H2,(H2-,3,4,5,6)/p+1 |
| InChIKey | TYISKOIWTUBNGQ-UHFFFAOYSA-O |
| XLogP | 0.03 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.04 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|