C20H22ClN3O — CID 90486781
N-[(Z)-[2-chloro-4-(methylamino)phenyl]methylideneamino]-2-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 90486781) has the molecular formula C20H22ClN3O and a molecular weight of 355.87 g/mol. Its IUPAC name is N-[(Z)-[2-chloro-4-(methylamino)phenyl]methylideneamino]-2-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | N-[(Z)-[2-chloro-4-(methylamino)phenyl]methylideneamino]-2-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 90486781 |
| Molecular Formula | C20H22ClN3O |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[(Z)-[2-chloro-4-(methylamino)phenyl]methylideneamino]-2-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | CNc1ccc(/C=N\NC(=O)Cc2cccc3c2CCCC3)c(Cl)c1 |
| InChI | InChI=1S/C20H22ClN3O/c1-22-17-10-9-16(19(21)12-17)13-23-24-20(25)11-15-7-4-6-14-5-2-3-8-18(14)15/h4,6-7,9-10,12-13,22H,2-3,5,8,11H2,1H3,(H,24,25)/b23-13- |
| InChIKey | AZVRBMCRDKPFKJ-QRVIBDJDSA-N |
| XLogP | 3.95 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|