C18H18Cl2N4S — CID 9058995
N-[4-[(Z)-N-(3,4-dichloroanilino)-C-methylcarbonimidoyl]phenyl]-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 9058995) has the molecular formula C18H18Cl2N4S and a molecular weight of 393.34 g/mol. Its IUPAC name is N-[4-[(Z)-N-(3,4-dichloroanilino)-C-methylcarbonimidoyl]phenyl]-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | N-[4-[(Z)-N-(3,4-dichloroanilino)-C-methylcarbonimidoyl]phenyl]-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 9058995 |
| Molecular Formula | C18H18Cl2N4S |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | N-[4-[(Z)-N-(3,4-dichloroanilino)-C-methylcarbonimidoyl]phenyl]-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | C/C(=N/Nc1ccc(Cl)c(Cl)c1)c1ccc(NC2=NCCCS2)cc1 |
| InChI | InChI=1S/C18H18Cl2N4S/c1-12(23-24-15-7-8-16(19)17(20)11-15)13-3-5-14(6-4-13)22-18-21-9-2-10-25-18/h3-8,11,24H,2,9-10H2,1H3,(H,21,22)/b23-12- |
| InChIKey | YULCPKLPLHNHMA-FMCGGJTJSA-N |
| XLogP | 5.73 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|