C29H26ClFN6O3 — CID 90702082
(4-fluorophenyl) 6-chloro-1-[4-[2-(1,3,5-triazin-2-ylamino)ethoxy]cyclohexa-1,3-dien-1-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 90702082) has the molecular formula C29H26ClFN6O3 and a molecular weight of 561.02 g/mol. Its IUPAC name is (4-fluorophenyl) 6-chloro-1-[4-[2-(1,3,5-triazin-2-ylamino)ethoxy]cyclohexa-1,3-dien-1-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-fluorophenyl) 6-chloro-1-[4-[2-(1,3,5-triazin-2-ylamino)ethoxy]cyclohexa-1,3-dien-1-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 90702082 |
| Molecular Formula | C29H26ClFN6O3 |
| Molecular Weight | 561.02 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | (4-fluorophenyl) 6-chloro-1-[4-[2-(1,3,5-triazin-2-ylamino)ethoxy]cyclohexa-1,3-dien-1-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | O=C(Oc1ccc(F)cc1)N1CCc2c([nH]c3ccc(Cl)cc23)C1C1=CC=C(OCCNc2ncncn2)CC1 |
| InChI | InChI=1S/C29H26ClFN6O3/c30-19-3-10-25-24(15-19)23-11-13-37(29(38)40-22-8-4-20(31)5-9-22)27(26(23)36-25)18-1-6-21(7-2-18)39-14-12-33-28-34-16-32-17-35-28/h1,3-6,8-10,15-17,27,36H,2,7,11-14H2,(H,32,33,34,35) |
| InChIKey | MAIBKJYVXKBGKE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.02 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|