C17H15Cl2F3N2O3S — CID 90722176
N-[4-chloro-2-[1-[(4-chlorophenoxy)amino]but-1-enyl]phenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 90722176) has the molecular formula C17H15Cl2F3N2O3S and a molecular weight of 455.29 g/mol. Its IUPAC name is N-[4-chloro-2-[1-[(4-chlorophenoxy)amino]but-1-enyl]phenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[4-chloro-2-[1-[(4-chlorophenoxy)amino]but-1-enyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 90722176 |
| Molecular Formula | C17H15Cl2F3N2O3S |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | N-[4-chloro-2-[1-[(4-chlorophenoxy)amino]but-1-enyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCC=C(NOc1ccc(Cl)cc1)c1cc(Cl)ccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H15Cl2F3N2O3S/c1-2-3-15(23-27-13-7-4-11(18)5-8-13)14-10-12(19)6-9-16(14)24-28(25,26)17(20,21)22/h3-10,23-24H,2H2,1H3 |
| InChIKey | VBYYDBUEHKFRQK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|