C22H28N4O4 — CID 90733818
(2S)-6-[[4-[(4-acetamidophenyl)methyl]phenyl]carbamoylamino]-2-aminohexanoic acid (PubChem CID 90733818) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is (2S)-6-[[4-[(4-acetamidophenyl)methyl]phenyl]carbamoylamino]-2-aminohexanoic acid.
| Compound Name | (2S)-6-[[4-[(4-acetamidophenyl)methyl]phenyl]carbamoylamino]-2-aminohexanoic acid |
|---|---|
| PubChem CID | 90733818 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (2S)-6-[[4-[(4-acetamidophenyl)methyl]phenyl]carbamoylamino]-2-aminohexanoic acid |
| SMILES | CC(=O)Nc1ccc(Cc2ccc(NC(=O)NCCCC[C@H](N)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C22H28N4O4/c1-15(27)25-18-9-5-16(6-10-18)14-17-7-11-19(12-8-17)26-22(30)24-13-3-2-4-20(23)21(28)29/h5-12,20H,2-4,13-14,23H2,1H3,(H,25,27)(H,28,29)(H2,24,26,30)/t20-/m0/s1 |
| InChIKey | VWOSGAYIYLNNAI-FQEVSTJZSA-N |
| XLogP | 2.94 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|