C26H33BrFN3O2 — CID 90770469
(1S,2R,3R,4R)-2-[(4-bromo-2-fluorophenyl)methyl]-3-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 90770469) has the molecular formula C26H33BrFN3O2 and a molecular weight of 518.47 g/mol. Its IUPAC name is (1S,2R,3R,4R)-2-[(4-bromo-2-fluorophenyl)methyl]-3-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1S,2R,3R,4R)-2-[(4-bromo-2-fluorophenyl)methyl]-3-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 90770469 |
| Molecular Formula | C26H33BrFN3O2 |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | (1S,2R,3R,4R)-2-[(4-bromo-2-fluorophenyl)methyl]-3-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | NC(=O)[C@]1(CCCCN2CCCC2)[C@@H]2C=C[C@@H](C23CC3)[C@@]1(Cc1ccc(Br)cc1F)C(N)=O |
| InChI | InChI=1S/C26H33BrFN3O2/c27-18-6-5-17(19(28)15-18)16-26(23(30)33)21-8-7-20(24(21)10-11-24)25(26,22(29)32)9-1-2-12-31-13-3-4-14-31/h5-8,15,20-21H,1-4,9-14,16H2,(H2,29,32)(H2,30,33)/t20-,21+,25+,26+/m1/s1 |
| InChIKey | YKCLWMKHYRGWOA-SYUUKGODSA-N |
| XLogP | 3.94 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|