C10H15N2O3P — CID 90771512
1-[(Z)-4-dimethylphosphorylbut-1-enyl]pyrimidine-2,4-dione (PubChem CID 90771512) has the molecular formula C10H15N2O3P and a molecular weight of 242.22 g/mol. Its IUPAC name is 1-[(Z)-4-dimethylphosphorylbut-1-enyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(Z)-4-dimethylphosphorylbut-1-enyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90771512 |
| Molecular Formula | C10H15N2O3P |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 1-[(Z)-4-dimethylphosphorylbut-1-enyl]pyrimidine-2,4-dione |
| SMILES | CP(C)(=O)CC/C=C\n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N2O3P/c1-16(2,15)8-4-3-6-12-7-5-9(13)11-10(12)14/h3,5-7H,4,8H2,1-2H3,(H,11,13,14)/b6-3- |
| InChIKey | AWVCMRJCJYCXHZ-UTCJRWHESA-N |
| XLogP | 1.02 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|