C18H18N6O2S — CID 90784243
[5-[6-(1H-benzimidazol-4-ylmethylsulfanyl)purin-9-yl]oxolan-2-yl]methanol (PubChem CID 90784243) has the molecular formula C18H18N6O2S and a molecular weight of 382.45 g/mol. Its IUPAC name is [5-[6-(1H-benzimidazol-4-ylmethylsulfanyl)purin-9-yl]oxolan-2-yl]methanol.
| Compound Name | [5-[6-(1H-benzimidazol-4-ylmethylsulfanyl)purin-9-yl]oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 90784243 |
| Molecular Formula | C18H18N6O2S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [5-[6-(1H-benzimidazol-4-ylmethylsulfanyl)purin-9-yl]oxolan-2-yl]methanol |
| SMILES | OCC1CCC(n2cnc3c(SCc4cccc5[nH]cnc45)ncnc32)O1 |
| InChI | InChI=1S/C18H18N6O2S/c25-6-12-4-5-14(26-12)24-10-23-16-17(24)21-9-22-18(16)27-7-11-2-1-3-13-15(11)20-8-19-13/h1-3,8-10,12,14,25H,4-7H2,(H,19,20) |
| InChIKey | BGKJTZULENRKOI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |