C10H19N2O3PS — CID 90786832
5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole (PubChem CID 90786832) has the molecular formula C10H19N2O3PS and a molecular weight of 278.31 g/mol. Its IUPAC name is 5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole.
| Compound Name | 5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 90786832 |
| Molecular Formula | C10H19N2O3PS |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole |
| SMILES | CCOP(=O)(Cc1nc(C(C)C)ns1)OCC |
| InChI | InChI=1S/C10H19N2O3PS/c1-5-14-16(13,15-6-2)7-9-11-10(8(3)4)12-17-9/h8H,5-7H2,1-4H3 |
| InChIKey | XMPPMCDDXGMNQN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|