About 5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole
5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole (PubChem CID 90786832) has the molecular formula C10H19N2O3PS
and a molecular weight of 278.31 g/mol. Its IUPAC name is 5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole |
| PubChem CID | 90786832 |
| Molecular Formula | C10H19N2O3PS |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole |
| SMILES | CCOP(=O)(Cc1nc(C(C)C)ns1)OCC |
| InChI | InChI=1S/C10H19N2O3PS/c1-5-14-16(13,15-6-2)7-9-11-10(8(3)4)12-17-9/h8H,5-7H2,1-4H3 |
| InChIKey | XMPPMCDDXGMNQN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole?
The IUPAC name of 5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole (CID 90786832) is 5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole.
What is the SMILES notation for 5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole?
The canonical SMILES for 5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole is CCOP(=O)(Cc1nc(C(C)C)ns1)OCC.
What is the InChIKey of 5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole?
The InChIKey is XMPPMCDDXGMNQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N2O3PS/c1-5-14-16(13,15-6-2)7-9-11-10(8(3)4)12-17-9/h8H,5-7H2,1-4H3.
What are the key properties of 5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole?
5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole has a molecular weight of 278.31 g/mol, XLogP of 3.43, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(diethoxyphosphorylmethyl)-3-propan-2-yl-1,2,4-thiadiazole is sourced from PubChem (CID 90786832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).