About 1-(dimethylidene-λ5-phosphanyl)ethanol
1-(dimethylidene-λ5-phosphanyl)ethanol (PubChem CID 90809058) has the molecular formula C4H9OP
and a molecular weight of 104.09 g/mol. Its IUPAC name is 1-(dimethylidene-λ5-phosphanyl)ethanol.
Molecular Properties
| Compound Name | 1-(dimethylidene-λ5-phosphanyl)ethanol |
| PubChem CID | 90809058 |
| Molecular Formula | C4H9OP |
| Molecular Weight | 104.09 g/mol |
| Exact Mass | 104.04 |
| IUPAC Name | 1-(dimethylidene-λ5-phosphanyl)ethanol |
| SMILES | C=P(=C)C(C)O |
| InChI | InChI=1S/C4H9OP/c1-4(5)6(2)3/h4-5H,2-3H2,1H3 |
| InChIKey | JWJVLYMQHCFNLA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.09 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylidene-λ5-phosphanyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylidene-λ5-phosphanyl)ethanol?
The IUPAC name of 1-(dimethylidene-λ5-phosphanyl)ethanol (CID 90809058) is 1-(dimethylidene-λ5-phosphanyl)ethanol.
What is the SMILES notation for 1-(dimethylidene-λ5-phosphanyl)ethanol?
The canonical SMILES for 1-(dimethylidene-λ5-phosphanyl)ethanol is C=P(=C)C(C)O.
What is the InChIKey of 1-(dimethylidene-λ5-phosphanyl)ethanol?
The InChIKey is JWJVLYMQHCFNLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9OP/c1-4(5)6(2)3/h4-5H,2-3H2,1H3.
What are the key properties of 1-(dimethylidene-λ5-phosphanyl)ethanol?
1-(dimethylidene-λ5-phosphanyl)ethanol has a molecular weight of 104.09 g/mol, XLogP of 0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylidene-λ5-phosphanyl)ethanol is sourced from PubChem (CID 90809058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).