C24H33NO3 — CID 90812510
3-icosa-5,8,11,14-tetraenoylpyrrole-2,5-dione (PubChem CID 90812510) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is 3-icosa-5,8,11,14-tetraenoylpyrrole-2,5-dione.
| Compound Name | 3-icosa-5,8,11,14-tetraenoylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 90812510 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | 3-icosa-5,8,11,14-tetraenoylpyrrole-2,5-dione |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)C1=CC(=O)NC1=O |
| InChI | InChI=1S/C24H33NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(26)21-20-23(27)25-24(21)28/h6-7,9-10,12-13,15-16,20H,2-5,8,11,14,17-19H2,1H3,(H,25,27,28) |
| InChIKey | NUHNWXMYHHNJDP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|