C34H22N6O14S2+2 — CID 90815967
[2-(2,4-dinitrophenyl)pyridin-1-ium-1-yl] 4-[4-[2-(2,4-dinitrophenyl)pyridin-1-ium-1-yl]oxysulfonylphenyl]benzenesulfonate (PubChem CID 90815967) has the molecular formula C34H22N6O14S2+2 and a molecular weight of 802.71 g/mol. Its IUPAC name is [2-(2,4-dinitrophenyl)pyridin-1-ium-1-yl] 4-[4-[2-(2,4-dinitrophenyl)pyridin-1-ium-1-yl]oxysulfonylphenyl]benzenesulfonate.
| Compound Name | [2-(2,4-dinitrophenyl)pyridin-1-ium-1-yl] 4-[4-[2-(2,4-dinitrophenyl)pyridin-1-ium-1-yl]oxysulfonylphenyl]benzenesulfonate |
|---|---|
| PubChem CID | 90815967 |
| Molecular Formula | C34H22N6O14S2+2 |
| Molecular Weight | 802.71 g/mol |
| Exact Mass | 802.06 |
| IUPAC Name | [2-(2,4-dinitrophenyl)pyridin-1-ium-1-yl] 4-[4-[2-(2,4-dinitrophenyl)pyridin-1-ium-1-yl]oxysulfonylphenyl]benzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(-c2cccc[n+]2OS(=O)(=O)c2ccc(-c3ccc(S(=O)(=O)O[n+]4ccccc4-c4ccc([N+](=O)[O-])cc4[N+](=O)[O-])cc3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H22N6O14S2/c41-37(42)25-11-17-29(33(21-25)39(45)46)31-5-1-3-19-35(31)53-55(49,50)27-13-7-23(8-14-27)24-9-15-28(16-10-24)56(51,52)54-36-20-4-2-6-32(36)30-18-12-26(38(43)44)22-34(30)40(47)48/h1-22H/q+2 |
| InChIKey | FLBQKFOJCKSXGL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 267.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.71 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|