C31H47N2O6S2Si+ — CID 90829686
[9-methyl-9-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-[tert-butyl(dimethyl)silyl]oxy-2,2-dithiophen-2-ylacetate (PubChem CID 90829686) has the molecular formula C31H47N2O6S2Si+ and a molecular weight of 635.95 g/mol. Its IUPAC name is [9-methyl-9-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-[tert-butyl(dimethyl)silyl]oxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [9-methyl-9-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-[tert-butyl(dimethyl)silyl]oxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 90829686 |
| Molecular Formula | C31H47N2O6S2Si+ |
| Molecular Weight | 635.95 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | [9-methyl-9-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-[tert-butyl(dimethyl)silyl]oxy-2,2-dithiophen-2-ylacetate |
| SMILES | CC(C)(C)OC(=O)NCC[N+]1(C)C2CC(OC(=O)C(O[Si](C)(C)C(C)(C)C)(c3cccs3)c3cccs3)CC1C1OC12 |
| InChI | InChI=1S/C31H46N2O6S2Si/c1-29(2,3)38-28(35)32-14-15-33(7)21-18-20(19-22(33)26-25(21)37-26)36-27(34)31(23-12-10-16-40-23,24-13-11-17-41-24)39-42(8,9)30(4,5)6/h10-13,16-17,20-22,25-26H,14-15,18-19H2,1-9H3/p+1 |
| InChIKey | KCTZGWCPADWCKW-UHFFFAOYSA-O |
| XLogP | 6.27 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.95 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|