C26H34N4O7 — CID 90844293
(4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-9-(piperidin-4-ylamino)-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 90844293) has the molecular formula C26H34N4O7 and a molecular weight of 514.58 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-9-(piperidin-4-ylamino)-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-9-(piperidin-4-ylamino)-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90844293 |
| Molecular Formula | C26H34N4O7 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-9-(piperidin-4-ylamino)-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(O)C(C(N)=O)C(=O)[C@]2(O)C(=O)C3C(=O)c4c(ccc(NC5CCNCC5)c4O)C[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C26H34N4O7/c1-30(2)19-14-10-12-9-11-3-4-15(29-13-5-7-28-8-6-13)20(31)16(11)21(32)17(12)23(34)26(14,37)24(35)18(22(19)33)25(27)36/h3-4,12-14,17-19,22,28-29,31,33,37H,5-10H2,1-2H3,(H2,27,36)/t12-,14-,17?,18?,19-,22?,26-/m1/s1 |
| InChIKey | HVGOBWJGYRNALN-CHYKSNCMSA-N |
| XLogP | -1.18 |
| TPSA | 182.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|