About methylidene-[3,6,7-tris(methylidenephosphanyl)anthracen-2-yl]phosphane
methylidene-[3,6,7-tris(methylidenephosphanyl)anthracen-2-yl]phosphane (PubChem CID 90846427) has the molecular formula C18H14P4
and a molecular weight of 354.21 g/mol. Its IUPAC name is methylidene-[3,6,7-tris(methylidenephosphanyl)anthracen-2-yl]phosphane.
Molecular Properties
| Compound Name | methylidene-[3,6,7-tris(methylidenephosphanyl)anthracen-2-yl]phosphane |
| PubChem CID | 90846427 |
| Molecular Formula | C18H14P4 |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | methylidene-[3,6,7-tris(methylidenephosphanyl)anthracen-2-yl]phosphane |
| SMILES | C=Pc1cc2cc3cc(P=C)c(P=C)cc3cc2cc1P=C |
| InChI | InChI=1S/C18H14P4/c1-19-15-7-11-5-13-9-17(21-3)18(22-4)10-14(13)6-12(11)8-16(15)20-2/h5-10H,1-4H2 |
| InChIKey | FXONUXZOGJIMLU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze methylidene-[3,6,7-tris(methylidenephosphanyl)anthracen-2-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylidene-[3,6,7-tris(methylidenephosphanyl)anthracen-2-yl]phosphane?
The IUPAC name of methylidene-[3,6,7-tris(methylidenephosphanyl)anthracen-2-yl]phosphane (CID 90846427) is methylidene-[3,6,7-tris(methylidenephosphanyl)anthracen-2-yl]phosphane.
What is the SMILES notation for methylidene-[3,6,7-tris(methylidenephosphanyl)anthracen-2-yl]phosphane?
The canonical SMILES for methylidene-[3,6,7-tris(methylidenephosphanyl)anthracen-2-yl]phosphane is C=Pc1cc2cc3cc(P=C)c(P=C)cc3cc2cc1P=C.
What is the InChIKey of methylidene-[3,6,7-tris(methylidenephosphanyl)anthracen-2-yl]phosphane?
The InChIKey is FXONUXZOGJIMLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14P4/c1-19-15-7-11-5-13-9-17(21-3)18(22-4)10-14(13)6-12(11)8-16(15)20-2/h5-10H,1-4H2.
What are the key properties of methylidene-[3,6,7-tris(methylidenephosphanyl)anthracen-2-yl]phosphane?
methylidene-[3,6,7-tris(methylidenephosphanyl)anthracen-2-yl]phosphane has a molecular weight of 354.21 g/mol, XLogP of 4.01, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methylidene-[3,6,7-tris(methylidenephosphanyl)anthracen-2-yl]phosphane is sourced from PubChem (CID 90846427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).