C18H23N4O6+ — CID 90854213
[6-amino-1,3-dioxo-2-(piperidine-1-carbonyloxy)isoindol-5-yl]-[(2-methylpropan-2-yl)oxy]-oxoazanium (PubChem CID 90854213) has the molecular formula C18H23N4O6+ and a molecular weight of 391.40 g/mol. Its IUPAC name is [6-amino-1,3-dioxo-2-(piperidine-1-carbonyloxy)isoindol-5-yl]-[(2-methylpropan-2-yl)oxy]-oxoazanium.
| Compound Name | [6-amino-1,3-dioxo-2-(piperidine-1-carbonyloxy)isoindol-5-yl]-[(2-methylpropan-2-yl)oxy]-oxoazanium |
|---|---|
| PubChem CID | 90854213 |
| Molecular Formula | C18H23N4O6+ |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | [6-amino-1,3-dioxo-2-(piperidine-1-carbonyloxy)isoindol-5-yl]-[(2-methylpropan-2-yl)oxy]-oxoazanium |
| SMILES | CC(C)(C)O[N+](=O)c1cc2c(cc1N)C(=O)N(OC(=O)N1CCCCC1)C2=O |
| InChI | InChI=1S/C18H22N4O6/c1-18(2,3)28-22(26)14-10-12-11(9-13(14)19)15(23)21(16(12)24)27-17(25)20-7-5-4-6-8-20/h9-10H,4-8H2,1-3H3,(H-,19,24,26)/p+1 |
| InChIKey | MTQARHXZNVIOMS-UHFFFAOYSA-O |
| XLogP | 2.54 |
| TPSA | 122.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|