C15H22ClN3O4S — CID 90881042
tert-butyl 3-[[2-chloro-4-(N'-methylcarbamimidoyl)phenyl]sulfonylamino]propanoate (PubChem CID 90881042) has the molecular formula C15H22ClN3O4S and a molecular weight of 375.88 g/mol. Its IUPAC name is tert-butyl 3-[[2-chloro-4-(N'-methylcarbamimidoyl)phenyl]sulfonylamino]propanoate.
| Compound Name | tert-butyl 3-[[2-chloro-4-(N'-methylcarbamimidoyl)phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 90881042 |
| Molecular Formula | C15H22ClN3O4S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | tert-butyl 3-[[2-chloro-4-(N'-methylcarbamimidoyl)phenyl]sulfonylamino]propanoate |
| SMILES | C/N=C(\N)c1ccc(S(=O)(=O)NCCC(=O)OC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C15H22ClN3O4S/c1-15(2,3)23-13(20)7-8-19-24(21,22)12-6-5-10(9-11(12)16)14(17)18-4/h5-6,9,19H,7-8H2,1-4H3,(H2,17,18) |
| InChIKey | YZQRGSNGWYVXFC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|