C17H19NO9S — CID 90885152
1-[4-[(2,5-dioxocyclopent-3-en-1-yl)methyl]cyclohexanecarbonyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 90885152) has the molecular formula C17H19NO9S and a molecular weight of 413.40 g/mol. Its IUPAC name is 1-[4-[(2,5-dioxocyclopent-3-en-1-yl)methyl]cyclohexanecarbonyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[4-[(2,5-dioxocyclopent-3-en-1-yl)methyl]cyclohexanecarbonyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 90885152 |
| Molecular Formula | C17H19NO9S |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 1-[4-[(2,5-dioxocyclopent-3-en-1-yl)methyl]cyclohexanecarbonyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | O=C(On1c(O)cc(S(=O)(=O)O)c1O)C1CCC(CC2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C17H19NO9S/c19-12-5-6-13(20)11(12)7-9-1-3-10(4-2-9)17(23)27-18-15(21)8-14(16(18)22)28(24,25)26/h5-6,8-11,21-22H,1-4,7H2,(H,24,25,26) |
| InChIKey | YEAOSHNJANOTMV-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 160.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|