C17H17Cl2NO2 — CID 90893874
5-[4-(2,4-dichlorophenyl)phenyl]-5-nitrosopentan-1-ol (PubChem CID 90893874) has the molecular formula C17H17Cl2NO2 and a molecular weight of 338.23 g/mol. Its IUPAC name is 5-[4-(2,4-dichlorophenyl)phenyl]-5-nitrosopentan-1-ol.
| Compound Name | 5-[4-(2,4-dichlorophenyl)phenyl]-5-nitrosopentan-1-ol |
|---|---|
| PubChem CID | 90893874 |
| Molecular Formula | C17H17Cl2NO2 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 5-[4-(2,4-dichlorophenyl)phenyl]-5-nitrosopentan-1-ol |
| SMILES | O=NC(CCCCO)c1ccc(-c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2NO2/c18-14-8-9-15(16(19)11-14)12-4-6-13(7-5-12)17(20-22)3-1-2-10-21/h4-9,11,17,21H,1-3,10H2 |
| InChIKey | FLVQHLZDMHNCJA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|