C25H31F5O — CID 90896577
(2,3,4,5,6-pentafluorophenyl)-[3-(4-propylcyclohexyl)spiro[3.5]nonan-8-yl]methanone (PubChem CID 90896577) has the molecular formula C25H31F5O and a molecular weight of 442.51 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)-[3-(4-propylcyclohexyl)spiro[3.5]nonan-8-yl]methanone.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)-[3-(4-propylcyclohexyl)spiro[3.5]nonan-8-yl]methanone |
|---|---|
| PubChem CID | 90896577 |
| Molecular Formula | C25H31F5O |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)-[3-(4-propylcyclohexyl)spiro[3.5]nonan-8-yl]methanone |
| SMILES | CCCC1CCC(C2CCC23CCCC(C(=O)c2c(F)c(F)c(F)c(F)c2F)C3)CC1 |
| InChI | InChI=1S/C25H31F5O/c1-2-4-14-6-8-15(9-7-14)17-10-12-25(17)11-3-5-16(13-25)24(31)18-19(26)21(28)23(30)22(29)20(18)27/h14-17H,2-13H2,1H3 |
| InChIKey | DBBBFWKGXSOLCE-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|