C13H13N5O8 — CID 90931384
bis(2,5-dihydroxypyrrol-1-yl) 2-azidopentanedioate (PubChem CID 90931384) has the molecular formula C13H13N5O8 and a molecular weight of 367.27 g/mol. Its IUPAC name is bis(2,5-dihydroxypyrrol-1-yl) 2-azidopentanedioate.
| Compound Name | bis(2,5-dihydroxypyrrol-1-yl) 2-azidopentanedioate |
|---|---|
| PubChem CID | 90931384 |
| Molecular Formula | C13H13N5O8 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | bis(2,5-dihydroxypyrrol-1-yl) 2-azidopentanedioate |
| SMILES | [N-]=[N+]=NC(CCC(=O)On1c(O)ccc1O)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C13H13N5O8/c14-16-15-7(13(24)26-18-10(21)4-5-11(18)22)1-6-12(23)25-17-8(19)2-3-9(17)20/h2-5,7,19-22H,1,6H2 |
| InChIKey | LSQXQLQAHYHJLV-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 192.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|