C10H13NO6 — CID 90938477
dimethyl 2-(2,5-dihydroxypyrrol-1-yl)butanedioate (PubChem CID 90938477) has the molecular formula C10H13NO6 and a molecular weight of 243.21 g/mol. Its IUPAC name is dimethyl 2-(2,5-dihydroxypyrrol-1-yl)butanedioate.
| Compound Name | dimethyl 2-(2,5-dihydroxypyrrol-1-yl)butanedioate |
|---|---|
| PubChem CID | 90938477 |
| Molecular Formula | C10H13NO6 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | dimethyl 2-(2,5-dihydroxypyrrol-1-yl)butanedioate |
| SMILES | COC(=O)CC(C(=O)OC)n1c(O)ccc1O |
| InChI | InChI=1S/C10H13NO6/c1-16-9(14)5-6(10(15)17-2)11-7(12)3-4-8(11)13/h3-4,6,12-13H,5H2,1-2H3 |
| InChIKey | HUPFQOBFVOJNJR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |