C16H28N2O7 — CID 90968149
(2R)-2-[4-methylpentanoyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]pentanedioic acid (PubChem CID 90968149) has the molecular formula C16H28N2O7 and a molecular weight of 360.41 g/mol. Its IUPAC name is (2R)-2-[4-methylpentanoyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]pentanedioic acid.
| Compound Name | (2R)-2-[4-methylpentanoyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]pentanedioic acid |
|---|---|
| PubChem CID | 90968149 |
| Molecular Formula | C16H28N2O7 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (2R)-2-[4-methylpentanoyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]pentanedioic acid |
| SMILES | CC(C)CCC(=O)N(NC(=O)OC(C)(C)C)[C@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H28N2O7/c1-10(2)6-8-12(19)18(17-15(24)25-16(3,4)5)11(14(22)23)7-9-13(20)21/h10-11H,6-9H2,1-5H3,(H,17,24)(H,20,21)(H,22,23)/t11-/m1/s1 |
| InChIKey | FVUMGYMBUZEJAQ-LLVKDONJSA-N |
| XLogP | 2.01 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|