C10H18N2 — CID 90988672
N,2-dipropylpyrrol-2-amine (PubChem CID 90988672) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N,2-dipropylpyrrol-2-amine.
| Compound Name | N,2-dipropylpyrrol-2-amine |
|---|---|
| PubChem CID | 90988672 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N,2-dipropylpyrrol-2-amine |
| SMILES | CCCNC1(CCC)C=CC=N1 |
| InChI | InChI=1S/C10H18N2/c1-3-6-10(11-8-4-2)7-5-9-12-10/h5,7,9,11H,3-4,6,8H2,1-2H3 |
| InChIKey | CEDVTCLSBUSWAJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |