C17H17F4N3O4S — CID 91034996
1-(1-hydroxy-2-methylpropan-2-yl)-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]urea (PubChem CID 91034996) has the molecular formula C17H17F4N3O4S and a molecular weight of 435.40 g/mol. Its IUPAC name is 1-(1-hydroxy-2-methylpropan-2-yl)-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]urea.
| Compound Name | 1-(1-hydroxy-2-methylpropan-2-yl)-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]urea |
|---|---|
| PubChem CID | 91034996 |
| Molecular Formula | C17H17F4N3O4S |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 1-(1-hydroxy-2-methylpropan-2-yl)-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]urea |
| SMILES | Cc1cn(-c2ccc3c(c2)OC(F)(F)C(F)(F)O3)c(=NC(=O)NC(C)(C)CO)s1 |
| InChI | InChI=1S/C17H17F4N3O4S/c1-9-7-24(14(29-9)22-13(26)23-15(2,3)8-25)10-4-5-11-12(6-10)28-17(20,21)16(18,19)27-11/h4-7,25H,8H2,1-3H3,(H,23,26) |
| InChIKey | PWEICDJTPYWFJT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|