C20H36N2O4S — CID 91055040
3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-[2-(2,5,5-trimethylhexan-2-yloxy)ethyl]propanamide (PubChem CID 91055040) has the molecular formula C20H36N2O4S and a molecular weight of 400.59 g/mol. Its IUPAC name is 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-[2-(2,5,5-trimethylhexan-2-yloxy)ethyl]propanamide.
| Compound Name | 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-[2-(2,5,5-trimethylhexan-2-yloxy)ethyl]propanamide |
|---|---|
| PubChem CID | 91055040 |
| Molecular Formula | C20H36N2O4S |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-[2-(2,5,5-trimethylhexan-2-yloxy)ethyl]propanamide |
| SMILES | CCSc1cc(O)n(CCC(=O)NCCOC(C)(C)CCC(C)(C)C)c1O |
| InChI | InChI=1S/C20H36N2O4S/c1-7-27-15-14-17(24)22(18(15)25)12-8-16(23)21-11-13-26-20(5,6)10-9-19(2,3)4/h14,24-25H,7-13H2,1-6H3,(H,21,23) |
| InChIKey | OKJUWNKZQHDCSP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|