C19H12F5N4O+ — CID 91057392
8-(2,3-difluorophenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]-7H-purin-1-ium (PubChem CID 91057392) has the molecular formula C19H12F5N4O+ and a molecular weight of 407.32 g/mol. Its IUPAC name is 8-(2,3-difluorophenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]-7H-purin-1-ium.
| Compound Name | 8-(2,3-difluorophenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]-7H-purin-1-ium |
|---|---|
| PubChem CID | 91057392 |
| Molecular Formula | C19H12F5N4O+ |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 8-(2,3-difluorophenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]-7H-purin-1-ium |
| SMILES | Fc1cccc(-c2nc3nc[n+](Cc4ccc(OC(F)(F)F)cc4)cc3[nH]2)c1F |
| InChI | InChI=1S/C19H11F5N4O/c20-14-3-1-2-13(16(14)21)17-26-15-9-28(10-25-18(15)27-17)8-11-4-6-12(7-5-11)29-19(22,23)24/h1-7,9-10H,8H2/p+1 |
| InChIKey | YANPKHCQOQRARG-UHFFFAOYSA-O |
| XLogP | 4.14 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|