C17H10ClF3N2O2 — CID 91065403
7-chloro-5-isocyano-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol (PubChem CID 91065403) has the molecular formula C17H10ClF3N2O2 and a molecular weight of 366.73 g/mol. Its IUPAC name is 7-chloro-5-isocyano-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol.
| Compound Name | 7-chloro-5-isocyano-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 91065403 |
| Molecular Formula | C17H10ClF3N2O2 |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 7-chloro-5-isocyano-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
| SMILES | [C-]#[N+]c1cc(Cl)c2c(O)n(Cc3ccc(OC(F)(F)F)cc3)cc2c1 |
| InChI | InChI=1S/C17H10ClF3N2O2/c1-22-12-6-11-9-23(16(24)15(11)14(18)7-12)8-10-2-4-13(5-3-10)25-17(19,20)21/h2-7,9,24H,8H2 |
| InChIKey | FXGNQPALECPXFH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 38.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|