C12H13F3O3 — CID 91084505
1,2,3-tris(fluoromethoxy)-4-prop-2-enylbenzene (PubChem CID 91084505) has the molecular formula C12H13F3O3 and a molecular weight of 262.23 g/mol. Its IUPAC name is 1,2,3-tris(fluoromethoxy)-4-prop-2-enylbenzene.
| Compound Name | 1,2,3-tris(fluoromethoxy)-4-prop-2-enylbenzene |
|---|---|
| PubChem CID | 91084505 |
| Molecular Formula | C12H13F3O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1,2,3-tris(fluoromethoxy)-4-prop-2-enylbenzene |
| SMILES | C=CCc1ccc(OCF)c(OCF)c1OCF |
| InChI | InChI=1S/C12H13F3O3/c1-2-3-9-4-5-10(16-6-13)12(18-8-15)11(9)17-7-14/h2,4-5H,1,3,6-8H2 |
| InChIKey | JSYHBBBICGSDAW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|