C53H106N6O3 — CID 91086867
3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propyl-[3-(2,2,4,4-tetramethylpentylimino)butyl]amino]-N-(2,2,4,4-tetramethylhexyl)propanamide (PubChem CID 91086867) has the molecular formula C53H106N6O3 and a molecular weight of 875.47 g/mol. Its IUPAC name is 3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propyl-[3-(2,2,4,4-tetramethylpentylimino)butyl]amino]-N-(2,2,4,4-tetramethylhexyl)propanamide.
| Compound Name | 3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propyl-[3-(2,2,4,4-tetramethylpentylimino)butyl]amino]-N-(2,2,4,4-tetramethylhexyl)propanamide |
|---|---|
| PubChem CID | 91086867 |
| Molecular Formula | C53H106N6O3 |
| Molecular Weight | 875.47 g/mol |
| Exact Mass | 874.83 |
| IUPAC Name | 3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propyl-[3-(2,2,4,4-tetramethylpentylimino)butyl]amino]-N-(2,2,4,4-tetramethylhexyl)propanamide |
| SMILES | CCC(C)(C)CC(C)(C)CNC(=O)CCN(CCCN(CCC(=O)NCC(C)(C)CC(C)(C)C)CCC(=O)NCC(C)(C)CC(C)(C)C)CC/C(C)=N/CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C53H106N6O3/c1-22-49(12,13)37-53(20,21)41-57-45(62)25-31-58(30-24-42(2)54-38-50(14,15)34-46(3,4)5)28-23-29-59(32-26-43(60)55-39-51(16,17)35-47(6,7)8)33-27-44(61)56-40-52(18,19)36-48(9,10)11/h22-41H2,1-21H3,(H,55,60)(H,56,61)(H,57,62)/b54-42+ |
| InChIKey | DCSCGMARULHJEO-ORVKXHLWSA-N |
| XLogP | 11.59 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.47 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|