About [2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-ethylcarbamic acid
[2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-ethylcarbamic acid (PubChem CID 91091274) has the molecular formula C15H22N2O5
and a molecular weight of 310.35 g/mol. Its IUPAC name is [2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-ethylcarbamic acid.
Molecular Properties
| Compound Name | [2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-ethylcarbamic acid |
| PubChem CID | 91091274 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-ethylcarbamic acid |
| SMILES | CCCN(CCc1cccc(O)c1O)C(=O)N(CC)C(=O)O |
| InChI | InChI=1S/C15H22N2O5/c1-3-9-16(14(20)17(4-2)15(21)22)10-8-11-6-5-7-12(18)13(11)19/h5-7,18-19H,3-4,8-10H2,1-2H3,(H,21,22) |
| InChIKey | IPKWRUZBYURCBZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-ethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-ethylcarbamic acid?
The IUPAC name of [2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-ethylcarbamic acid (CID 91091274) is [2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-ethylcarbamic acid.
What is the SMILES notation for [2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-ethylcarbamic acid?
The canonical SMILES for [2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-ethylcarbamic acid is CCCN(CCc1cccc(O)c1O)C(=O)N(CC)C(=O)O.
What is the InChIKey of [2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-ethylcarbamic acid?
The InChIKey is IPKWRUZBYURCBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O5/c1-3-9-16(14(20)17(4-2)15(21)22)10-8-11-6-5-7-12(18)13(11)19/h5-7,18-19H,3-4,8-10H2,1-2H3,(H,21,22).
What are the key properties of [2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-ethylcarbamic acid?
[2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-ethylcarbamic acid has a molecular weight of 310.35 g/mol, XLogP of 2.47, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-ethylcarbamic acid is sourced from PubChem (CID 91091274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).