C16H27N3O6 — CID 91096275
N-[(2,5-dioxopyrrol-1-yl)methyl]-4-methoxybutanamide;4-methoxy-N-methylbutanamide (PubChem CID 91096275) has the molecular formula C16H27N3O6 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[(2,5-dioxopyrrol-1-yl)methyl]-4-methoxybutanamide;4-methoxy-N-methylbutanamide.
| Compound Name | N-[(2,5-dioxopyrrol-1-yl)methyl]-4-methoxybutanamide;4-methoxy-N-methylbutanamide |
|---|---|
| PubChem CID | 91096275 |
| Molecular Formula | C16H27N3O6 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N-[(2,5-dioxopyrrol-1-yl)methyl]-4-methoxybutanamide;4-methoxy-N-methylbutanamide |
| SMILES | CNC(=O)CCCOC.COCCCC(=O)NCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H14N2O4.C6H13NO2/c1-16-6-2-3-8(13)11-7-12-9(14)4-5-10(12)15;1-7-6(8)4-3-5-9-2/h4-5H,2-3,6-7H2,1H3,(H,11,13);3-5H2,1-2H3,(H,7,8) |
| InChIKey | ZNBBAGVGZXSFEX-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|