C18H30O6Si — CID 91102862
[(1R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-hydroxypropylidene)-7-oxo-6-oxabicyclo[3.2.1]octan-1-yl] acetate (PubChem CID 91102862) has the molecular formula C18H30O6Si and a molecular weight of 370.52 g/mol. Its IUPAC name is [(1R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-hydroxypropylidene)-7-oxo-6-oxabicyclo[3.2.1]octan-1-yl] acetate.
| Compound Name | [(1R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-hydroxypropylidene)-7-oxo-6-oxabicyclo[3.2.1]octan-1-yl] acetate |
|---|---|
| PubChem CID | 91102862 |
| Molecular Formula | C18H30O6Si |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | [(1R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-hydroxypropylidene)-7-oxo-6-oxabicyclo[3.2.1]octan-1-yl] acetate |
| SMILES | CC(=O)O[C@@]12C[C@@H](OC1=O)C(=CCCO)[C@H](O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C18H30O6Si/c1-12(20)23-18-10-14(22-16(18)21)13(8-7-9-19)15(11-18)24-25(5,6)17(2,3)4/h8,14-15,19H,7,9-11H2,1-6H3/t14-,15-,18-/m1/s1 |
| InChIKey | RBZRNXFXCIQWPT-IIDMSEBBSA-N |
| XLogP | 2.71 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|