C18H28 — CID 91107340
9,9-dimethylhexadec-7-en-1,15-diyne (PubChem CID 91107340) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is 9,9-dimethylhexadec-7-en-1,15-diyne.
| Compound Name | 9,9-dimethylhexadec-7-en-1,15-diyne |
|---|---|
| PubChem CID | 91107340 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 9,9-dimethylhexadec-7-en-1,15-diyne |
| SMILES | C#CCCCCC=CC(C)(C)CCCCCC#C |
| InChI | InChI=1S/C18H28/c1-5-7-9-11-13-15-17-18(3,4)16-14-12-10-8-6-2/h1-2,15,17H,7-14,16H2,3-4H3 |
| InChIKey | JIQFJXMENKWKRH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|