C20H27N3O2S — CID 91110539
O-[[3-(4-methylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-cyclopentylcarbamothioate (PubChem CID 91110539) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is O-[[3-(4-methylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-cyclopentylcarbamothioate.
| Compound Name | O-[[3-(4-methylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-cyclopentylcarbamothioate |
|---|---|
| PubChem CID | 91110539 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | O-[[3-(4-methylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-cyclopentylcarbamothioate |
| SMILES | Cc1ccc(C2=CC3(CCN(OC(=S)NC4CCCC4)CC3)ON2)cc1 |
| InChI | InChI=1S/C20H27N3O2S/c1-15-6-8-16(9-7-15)18-14-20(25-22-18)10-12-23(13-11-20)24-19(26)21-17-4-2-3-5-17/h6-9,14,17,22H,2-5,10-13H2,1H3,(H,21,26) |
| InChIKey | DCMCRBLOYMVGND-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|