C32H46N6O6Si — CID 91112909
(8R,8aS)-8-azido-2,7-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine;(3S,4R)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxan-3-ol (PubChem CID 91112909) has the molecular formula C32H46N6O6Si and a molecular weight of 638.84 g/mol. Its IUPAC name is (8R,8aS)-8-azido-2,7-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine;(3S,4R)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxan-3-ol.
| Compound Name | (8R,8aS)-8-azido-2,7-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine;(3S,4R)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxan-3-ol |
|---|---|
| PubChem CID | 91112909 |
| Molecular Formula | C32H46N6O6Si |
| Molecular Weight | 638.84 g/mol |
| Exact Mass | 638.32 |
| IUPAC Name | (8R,8aS)-8-azido-2,7-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine;(3S,4R)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxan-3-ol |
| SMILES | CC1COC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@@H]1N=[N+]=[N-].CC1OCC2OCC(C)[C@@H](N=[N+]=[N-])[C@@H]2O1 |
| InChI | InChI=1S/C23H31N3O3Si.C9H15N3O3/c1-17-15-28-20(22(27)21(17)25-26-24)16-29-30(23(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19;1-5-3-14-7-4-13-6(2)15-9(7)8(5)11-12-10/h5-14,17,20-22,27H,15-16H2,1-4H3;5-9H,3-4H2,1-2H3/t17?,20?,21-,22-;5?,6?,7?,8-,9-/m11/s1 |
| InChIKey | VWLGBKUGJUOLCM-CIPGQRCYSA-N |
| XLogP | 5.10 |
| TPSA | 163.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.84 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|