C21H27FN2O4 — CID 91122220
[4-fluoro-5-[prop-2-enyl(prop-2-enylcarbamoyl)amino]-2-propyloxolan-3-yl] benzoate (PubChem CID 91122220) has the molecular formula C21H27FN2O4 and a molecular weight of 390.46 g/mol. Its IUPAC name is [4-fluoro-5-[prop-2-enyl(prop-2-enylcarbamoyl)amino]-2-propyloxolan-3-yl] benzoate.
| Compound Name | [4-fluoro-5-[prop-2-enyl(prop-2-enylcarbamoyl)amino]-2-propyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 91122220 |
| Molecular Formula | C21H27FN2O4 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | [4-fluoro-5-[prop-2-enyl(prop-2-enylcarbamoyl)amino]-2-propyloxolan-3-yl] benzoate |
| SMILES | C=CCNC(=O)N(CC=C)C1OC(CCC)C(OC(=O)c2ccccc2)C1F |
| InChI | InChI=1S/C21H27FN2O4/c1-4-10-16-18(28-20(25)15-11-8-7-9-12-15)17(22)19(27-16)24(14-6-3)21(26)23-13-5-2/h5-9,11-12,16-19H,2-4,10,13-14H2,1H3,(H,23,26) |
| InChIKey | XHVIOANDKSLPDA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|