C16H21N4O4+ — CID 91128955
[2-cyano-3-(piperazine-1-carbonyloxy)phenyl]-[(2-methylpropan-2-yl)oxy]-oxoazanium (PubChem CID 91128955) has the molecular formula C16H21N4O4+ and a molecular weight of 333.37 g/mol. Its IUPAC name is [2-cyano-3-(piperazine-1-carbonyloxy)phenyl]-[(2-methylpropan-2-yl)oxy]-oxoazanium.
| Compound Name | [2-cyano-3-(piperazine-1-carbonyloxy)phenyl]-[(2-methylpropan-2-yl)oxy]-oxoazanium |
|---|---|
| PubChem CID | 91128955 |
| Molecular Formula | C16H21N4O4+ |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [2-cyano-3-(piperazine-1-carbonyloxy)phenyl]-[(2-methylpropan-2-yl)oxy]-oxoazanium |
| SMILES | CC(C)(C)O[N+](=O)c1cccc(OC(=O)N2CCNCC2)c1C#N |
| InChI | InChI=1S/C16H21N4O4/c1-16(2,3)24-20(22)13-5-4-6-14(12(13)11-17)23-15(21)19-9-7-18-8-10-19/h4-6,18H,7-10H2,1-3H3/q+1 |
| InChIKey | HEOPYWGNNIUUMD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|