C28H33F5N6O2 — CID 159713722
tert-butyl piperazine-1-carboxylate;3,6-difluoro-2-(4-methylpiperazin-1-yl)benzonitrile;2,3,6-trifluorobenzonitrile (PubChem CID 159713722) has the molecular formula C28H33F5N6O2 and a molecular weight of 580.60 g/mol. Its IUPAC name is tert-butyl piperazine-1-carboxylate;3,6-difluoro-2-(4-methylpiperazin-1-yl)benzonitrile;2,3,6-trifluorobenzonitrile.
| Compound Name | tert-butyl piperazine-1-carboxylate;3,6-difluoro-2-(4-methylpiperazin-1-yl)benzonitrile;2,3,6-trifluorobenzonitrile |
|---|---|
| PubChem CID | 159713722 |
| Molecular Formula | C28H33F5N6O2 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | tert-butyl piperazine-1-carboxylate;3,6-difluoro-2-(4-methylpiperazin-1-yl)benzonitrile;2,3,6-trifluorobenzonitrile |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.CN1CCN(c2c(F)ccc(F)c2C#N)CC1.N#Cc1c(F)ccc(F)c1F |
| InChI | InChI=1S/C12H13F2N3.C9H18N2O2.C7H2F3N/c1-16-4-6-17(7-5-16)12-9(8-15)10(13)2-3-11(12)14;1-9(2,3)13-8(12)11-6-4-10-5-7-11;8-5-1-2-6(9)7(10)4(5)3-11/h2-3H,4-7H2,1H3;10H,4-7H2,1-3H3;1-2H |
| InChIKey | MZDWWBSDWKZYIA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|